C23H28Cl2O5S2 — CID 141070603
1,9-bis(benzylsulfonyl)-4,6-dichlorononan-5-one (PubChem CID 141070603) has the molecular formula C23H28Cl2O5S2 and a molecular weight of 519.51 g/mol. Its IUPAC name is 1,9-bis(benzylsulfonyl)-4,6-dichlorononan-5-one.
| Compound Name | 1,9-bis(benzylsulfonyl)-4,6-dichlorononan-5-one |
|---|---|
| PubChem CID | 141070603 |
| Molecular Formula | C23H28Cl2O5S2 |
| Molecular Weight | 519.51 g/mol |
| Exact Mass | 518.08 |
| IUPAC Name | 1,9-bis(benzylsulfonyl)-4,6-dichlorononan-5-one |
| SMILES | O=C(C(Cl)CCCS(=O)(=O)Cc1ccccc1)C(Cl)CCCS(=O)(=O)Cc1ccccc1 |
| InChI | InChI=1S/C23H28Cl2O5S2/c24-21(13-7-15-31(27,28)17-19-9-3-1-4-10-19)23(26)22(25)14-8-16-32(29,30)18-20-11-5-2-6-12-20/h1-6,9-12,21-22H,7-8,13-18H2 |
| InChIKey | UJJHVDWDQDKCMP-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 85.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.51 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|