About 8-benzylsulfonyloctanoic acid
8-benzylsulfonyloctanoic acid (PubChem CID 66874848) has the molecular formula C15H22O4S
and a molecular weight of 298.40 g/mol. Its IUPAC name is 8-benzylsulfonyloctanoic acid.
Molecular Properties
| Compound Name | 8-benzylsulfonyloctanoic acid |
| PubChem CID | 66874848 |
| Molecular Formula | C15H22O4S |
| Molecular Weight | 298.40 g/mol |
| Exact Mass | 298.12 |
| IUPAC Name | 8-benzylsulfonyloctanoic acid |
| SMILES | O=C(O)CCCCCCCS(=O)(=O)Cc1ccccc1 |
| InChI | InChI=1S/C15H22O4S/c16-15(17)11-7-2-1-3-8-12-20(18,19)13-14-9-5-4-6-10-14/h4-6,9-10H,1-3,7-8,11-13H2,(H,16,17) |
| InChIKey | IDDMSSFZLQDNDK-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 71.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 298.40 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 8-benzylsulfonyloctanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-benzylsulfonyloctanoic acid?
The IUPAC name of 8-benzylsulfonyloctanoic acid (CID 66874848) is 8-benzylsulfonyloctanoic acid.
What is the SMILES notation for 8-benzylsulfonyloctanoic acid?
The canonical SMILES for 8-benzylsulfonyloctanoic acid is O=C(O)CCCCCCCS(=O)(=O)Cc1ccccc1.
What is the InChIKey of 8-benzylsulfonyloctanoic acid?
The InChIKey is IDDMSSFZLQDNDK-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H22O4S/c16-15(17)11-7-2-1-3-8-12-20(18,19)13-14-9-5-4-6-10-14/h4-6,9-10H,1-3,7-8,11-13H2,(H,16,17).
What are the key properties of 8-benzylsulfonyloctanoic acid?
8-benzylsulfonyloctanoic acid has a molecular weight of 298.40 g/mol, XLogP of 3.03, 10 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 8-benzylsulfonyloctanoic acid is sourced from PubChem (CID 66874848), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).