C15H14N2O6S — CID 56636398
(6S)-3,8-dioxo-7-[(2-phenoxyacetyl)amino]-5-thia-1-azabicyclo[4.2.0]octane-7-carboxylic acid (PubChem CID 56636398) has the molecular formula C15H14N2O6S and a molecular weight of 350.35 g/mol. Its IUPAC name is (6S)-3,8-dioxo-7-[(2-phenoxyacetyl)amino]-5-thia-1-azabicyclo[4.2.0]octane-7-carboxylic acid.
| Compound Name | (6S)-3,8-dioxo-7-[(2-phenoxyacetyl)amino]-5-thia-1-azabicyclo[4.2.0]octane-7-carboxylic acid |
|---|---|
| PubChem CID | 56636398 |
| Molecular Formula | C15H14N2O6S |
| Molecular Weight | 350.35 g/mol |
| Exact Mass | 350.06 |
| IUPAC Name | (6S)-3,8-dioxo-7-[(2-phenoxyacetyl)amino]-5-thia-1-azabicyclo[4.2.0]octane-7-carboxylic acid |
| SMILES | O=C1CS[C@@H]2N(C1)C(=O)C2(NC(=O)COc1ccccc1)C(=O)O |
| InChI | InChI=1S/C15H14N2O6S/c18-9-6-17-12(20)15(14(21)22,13(17)24-8-9)16-11(19)7-23-10-4-2-1-3-5-10/h1-5,13H,6-8H2,(H,16,19)(H,21,22)/t13-,15?/m0/s1 |
| InChIKey | DJXFCQMVGGARGY-CFMCSPIPSA-N |
| XLogP | -0.51 |
| TPSA | 113.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.35 |
| LogP ≤ 5 | -0.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|