C22H21N3O6S — CID 18635497
benzyl (5S,6R)-6-formamido-7-oxo-6-[(2-phenoxyacetyl)amino]-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate (PubChem CID 18635497) has the molecular formula C22H21N3O6S and a molecular weight of 455.49 g/mol. Its IUPAC name is benzyl (5S,6R)-6-formamido-7-oxo-6-[(2-phenoxyacetyl)amino]-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate.
| Compound Name | benzyl (5S,6R)-6-formamido-7-oxo-6-[(2-phenoxyacetyl)amino]-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate |
|---|---|
| PubChem CID | 18635497 |
| Molecular Formula | C22H21N3O6S |
| Molecular Weight | 455.49 g/mol |
| Exact Mass | 455.12 |
| IUPAC Name | benzyl (5S,6R)-6-formamido-7-oxo-6-[(2-phenoxyacetyl)amino]-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate |
| SMILES | O=CN[C@@]1(NC(=O)COc2ccccc2)C(=O)N2C(C(=O)OCc3ccccc3)CS[C@H]21 |
| InChI | InChI=1S/C22H21N3O6S/c26-14-23-22(24-18(27)12-30-16-9-5-2-6-10-16)20(29)25-17(13-32-21(22)25)19(28)31-11-15-7-3-1-4-8-15/h1-10,14,17,21H,11-13H2,(H,23,26)(H,24,27)/t17?,21-,22+/m0/s1 |
| InChIKey | LHJPWKXTRIHAEK-UOKKUGRISA-N |
| XLogP | 0.65 |
| TPSA | 114.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.49 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|