C19H20Cl3N3O7S — CID 88628760
benzyl (2S,5R,6R)-6-formamido-3,3-dimethyl-4,7-dioxo-6-(1,1,2-trichloroethoxycarbonylamino)-4λ4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate (PubChem CID 88628760) has the molecular formula C19H20Cl3N3O7S and a molecular weight of 540.81 g/mol. Its IUPAC name is benzyl (2S,5R,6R)-6-formamido-3,3-dimethyl-4,7-dioxo-6-(1,1,2-trichloroethoxycarbonylamino)-4λ4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate.
| Compound Name | benzyl (2S,5R,6R)-6-formamido-3,3-dimethyl-4,7-dioxo-6-(1,1,2-trichloroethoxycarbonylamino)-4λ4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate |
|---|---|
| PubChem CID | 88628760 |
| Molecular Formula | C19H20Cl3N3O7S |
| Molecular Weight | 540.81 g/mol |
| Exact Mass | 539.01 |
| IUPAC Name | benzyl (2S,5R,6R)-6-formamido-3,3-dimethyl-4,7-dioxo-6-(1,1,2-trichloroethoxycarbonylamino)-4λ4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate |
| SMILES | CC1(C)[C@H](C(=O)OCc2ccccc2)N2C(=O)[C@@](NC=O)(NC(=O)OC(Cl)(Cl)CCl)[C@H]2S1=O |
| InChI | InChI=1S/C19H20Cl3N3O7S/c1-17(2)12(13(27)31-8-11-6-4-3-5-7-11)25-14(28)19(23-10-26,15(25)33(17)30)24-16(29)32-18(21,22)9-20/h3-7,10,12,15H,8-9H2,1-2H3,(H,23,26)(H,24,29)/t12-,15+,19+,33?/m0/s1 |
| InChIKey | ZFRYLVPEMBEEMU-NPUDIYLOSA-N |
| XLogP | 1.35 |
| TPSA | 131.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.81 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|