C34H26Cl2N4O2 — CID 56636429
2,5-dichloro-3,6-bis[(9-ethylcarbazol-3-yl)imino]cyclohexane-1,4-dione (PubChem CID 56636429) has the molecular formula C34H26Cl2N4O2 and a molecular weight of 593.51 g/mol. Its IUPAC name is 2,5-dichloro-3,6-bis[(9-ethylcarbazol-3-yl)imino]cyclohexane-1,4-dione.
| Compound Name | 2,5-dichloro-3,6-bis[(9-ethylcarbazol-3-yl)imino]cyclohexane-1,4-dione |
|---|---|
| PubChem CID | 56636429 |
| Molecular Formula | C34H26Cl2N4O2 |
| Molecular Weight | 593.51 g/mol |
| Exact Mass | 592.14 |
| IUPAC Name | 2,5-dichloro-3,6-bis[(9-ethylcarbazol-3-yl)imino]cyclohexane-1,4-dione |
| SMILES | CCn1c2ccccc2c2cc(/N=C3\C(=O)C(Cl)/C(=N/c4ccc5c(c4)c4ccccc4n5CC)C(=O)C3Cl)ccc21 |
| InChI | InChI=1S/C34H26Cl2N4O2/c1-3-39-25-11-7-5-9-21(25)23-17-19(13-15-27(23)39)37-31-29(35)34(42)32(30(36)33(31)41)38-20-14-16-28-24(18-20)22-10-6-8-12-26(22)40(28)4-2/h5-18,29-30H,3-4H2,1-2H3/b37-31-,38-32- |
| InChIKey | PMGPWANXRAWDKO-ZNUUIMKISA-N |
| XLogP | 8.15 |
| TPSA | 68.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.51 |
| LogP ≤ 5 | 8.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|