C26H26N2O11 — CID 56637859
7-[(2S,3R,4R,5R,6S)-3,4,5-triacetyl-3-amino-4,5-dihydroxy-6-(2-hydroxypropanoyl)oxan-2-yl]oxyphenoxazin-3-one (PubChem CID 56637859) has the molecular formula C26H26N2O11 and a molecular weight of 542.50 g/mol. Its IUPAC name is 7-[(2S,3R,4R,5R,6S)-3,4,5-triacetyl-3-amino-4,5-dihydroxy-6-(2-hydroxypropanoyl)oxan-2-yl]oxyphenoxazin-3-one.
| Compound Name | 7-[(2S,3R,4R,5R,6S)-3,4,5-triacetyl-3-amino-4,5-dihydroxy-6-(2-hydroxypropanoyl)oxan-2-yl]oxyphenoxazin-3-one |
|---|---|
| PubChem CID | 56637859 |
| Molecular Formula | C26H26N2O11 |
| Molecular Weight | 542.50 g/mol |
| Exact Mass | 542.15 |
| IUPAC Name | 7-[(2S,3R,4R,5R,6S)-3,4,5-triacetyl-3-amino-4,5-dihydroxy-6-(2-hydroxypropanoyl)oxan-2-yl]oxyphenoxazin-3-one |
| SMILES | CC(=O)[C@]1(O)[C@@](O)(C(C)=O)[C@@H](C(=O)C(C)O)O[C@@H](Oc2ccc3nc4ccc(=O)cc-4oc3c2)[C@@]1(N)C(C)=O |
| InChI | InChI=1S/C26H26N2O11/c1-11(29)21(34)22-25(35,13(3)31)26(36,14(4)32)24(27,12(2)30)23(39-22)37-16-6-8-18-20(10-16)38-19-9-15(33)5-7-17(19)28-18/h5-11,22-23,29,35-36H,27H2,1-4H3/t11?,22-,23-,24+,25-,26-/m1/s1 |
| InChIKey | FOJAUHQWWXIHSI-XNLHRKJXSA-N |
| XLogP | -0.73 |
| TPSA | 216.55 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.50 |
| LogP ≤ 5 | -0.73 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|