About [4-(2-methyl-3-phenylprop-2-enoyl)peroxycarbonylphenyl] 4-decoxybenzoate
[4-(2-methyl-3-phenylprop-2-enoyl)peroxycarbonylphenyl] 4-decoxybenzoate (PubChem CID 56639344) has the molecular formula C34H38O7
and a molecular weight of 558.67 g/mol. Its IUPAC name is [4-(2-methyl-3-phenylprop-2-enoyl)peroxycarbonylphenyl] 4-decoxybenzoate.
Molecular Properties
| Compound Name | [4-(2-methyl-3-phenylprop-2-enoyl)peroxycarbonylphenyl] 4-decoxybenzoate |
| PubChem CID | 56639344 |
| Molecular Formula | C34H38O7 |
| Molecular Weight | 558.67 g/mol |
| Exact Mass | 558.26 |
| IUPAC Name | [4-(2-methyl-3-phenylprop-2-enoyl)peroxycarbonylphenyl] 4-decoxybenzoate |
| SMILES | CCCCCCCCCCOc1ccc(C(=O)Oc2ccc(C(=O)OOC(=O)C(C)=Cc3ccccc3)cc2)cc1 |
| InChI | InChI=1S/C34H38O7/c1-3-4-5-6-7-8-9-13-24-38-30-20-16-28(17-21-30)33(36)39-31-22-18-29(19-23-31)34(37)41-40-32(35)26(2)25-27-14-11-10-12-15-27/h10-12,14-23,25H,3-9,13,24H2,1-2H3 |
| InChIKey | QPVNPYPJARGDQU-UHFFFAOYSA-N |
| XLogP | 8.14 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 41 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 558.67 |
| LogP ≤ 5 | 8.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze [4-(2-methyl-3-phenylprop-2-enoyl)peroxycarbonylphenyl] 4-decoxybenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-(2-methyl-3-phenylprop-2-enoyl)peroxycarbonylphenyl] 4-decoxybenzoate?
The IUPAC name of [4-(2-methyl-3-phenylprop-2-enoyl)peroxycarbonylphenyl] 4-decoxybenzoate (CID 56639344) is [4-(2-methyl-3-phenylprop-2-enoyl)peroxycarbonylphenyl] 4-decoxybenzoate.
What is the SMILES notation for [4-(2-methyl-3-phenylprop-2-enoyl)peroxycarbonylphenyl] 4-decoxybenzoate?
The canonical SMILES for [4-(2-methyl-3-phenylprop-2-enoyl)peroxycarbonylphenyl] 4-decoxybenzoate is CCCCCCCCCCOc1ccc(C(=O)Oc2ccc(C(=O)OOC(=O)C(C)=Cc3ccccc3)cc2)cc1.
What is the InChIKey of [4-(2-methyl-3-phenylprop-2-enoyl)peroxycarbonylphenyl] 4-decoxybenzoate?
The InChIKey is QPVNPYPJARGDQU-UHFFFAOYSA-N. The full InChI is InChI=1S/C34H38O7/c1-3-4-5-6-7-8-9-13-24-38-30-20-16-28(17-21-30)33(36)39-31-22-18-29(19-23-31)34(37)41-40-32(35)26(2)25-27-14-11-10-12-15-27/h10-12,14-23,25H,3-9,13,24H2,1-2H3.
What are the key properties of [4-(2-methyl-3-phenylprop-2-enoyl)peroxycarbonylphenyl] 4-decoxybenzoate?
[4-(2-methyl-3-phenylprop-2-enoyl)peroxycarbonylphenyl] 4-decoxybenzoate has a molecular weight of 558.67 g/mol, XLogP of 8.14, 15 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for [4-(2-methyl-3-phenylprop-2-enoyl)peroxycarbonylphenyl] 4-decoxybenzoate is sourced from PubChem (CID 56639344), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).