C24H25N5OS — CID 56639677
3-[[4-[1-(5-ethylpyrimidin-2-yl)piperidin-4-yl]oxy-2-sulfanylidene-1-pyridinyl]methyl]benzonitrile (PubChem CID 56639677) has the molecular formula C24H25N5OS and a molecular weight of 431.57 g/mol. Its IUPAC name is 3-[[4-[1-(5-ethylpyrimidin-2-yl)piperidin-4-yl]oxy-2-sulfanylidene-1-pyridinyl]methyl]benzonitrile.
| Compound Name | 3-[[4-[1-(5-ethylpyrimidin-2-yl)piperidin-4-yl]oxy-2-sulfanylidene-1-pyridinyl]methyl]benzonitrile |
|---|---|
| PubChem CID | 56639677 |
| Molecular Formula | C24H25N5OS |
| Molecular Weight | 431.57 g/mol |
| Exact Mass | 431.18 |
| IUPAC Name | 3-[[4-[1-(5-ethylpyrimidin-2-yl)piperidin-4-yl]oxy-2-sulfanylidene-1-pyridinyl]methyl]benzonitrile |
| SMILES | CCc1cnc(N2CCC(Oc3ccn(Cc4cccc(C#N)c4)c(=S)c3)CC2)nc1 |
| InChI | InChI=1S/C24H25N5OS/c1-2-18-15-26-24(27-16-18)28-9-6-21(7-10-28)30-22-8-11-29(23(31)13-22)17-20-5-3-4-19(12-20)14-25/h3-5,8,11-13,15-16,21H,2,6-7,9-10,17H2,1H3 |
| InChIKey | WCNMUEKZBUQNKO-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 66.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.57 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|