C24H24N6O6 — CID 56640323
4-[2-[[3-[[(4-carboxyanilino)carbamoylamino]methyl]phenyl]methylcarbamoyl]hydrazinyl]benzoic acid (PubChem CID 56640323) has the molecular formula C24H24N6O6 and a molecular weight of 492.49 g/mol. Its IUPAC name is 4-[2-[[3-[[(4-carboxyanilino)carbamoylamino]methyl]phenyl]methylcarbamoyl]hydrazinyl]benzoic acid.
| Compound Name | 4-[2-[[3-[[(4-carboxyanilino)carbamoylamino]methyl]phenyl]methylcarbamoyl]hydrazinyl]benzoic acid |
|---|---|
| PubChem CID | 56640323 |
| Molecular Formula | C24H24N6O6 |
| Molecular Weight | 492.49 g/mol |
| Exact Mass | 492.18 |
| IUPAC Name | 4-[2-[[3-[[(4-carboxyanilino)carbamoylamino]methyl]phenyl]methylcarbamoyl]hydrazinyl]benzoic acid |
| SMILES | O=C(NCc1cccc(CNC(=O)NNc2ccc(C(=O)O)cc2)c1)NNc1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C24H24N6O6/c31-21(32)17-4-8-19(9-5-17)27-29-23(35)25-13-15-2-1-3-16(12-15)14-26-24(36)30-28-20-10-6-18(7-11-20)22(33)34/h1-12,27-28H,13-14H2,(H,31,32)(H,33,34)(H2,25,29,35)(H2,26,30,36) |
| InChIKey | FFIVWRBRIXMXCO-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 180.92 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.49 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|