C14H16N6O2 — CID 71893363
N-[3-[[(pyrimidin-2-ylamino)carbamoylamino]methyl]phenyl]acetamide (PubChem CID 71893363) has the molecular formula C14H16N6O2 and a molecular weight of 300.32 g/mol. Its IUPAC name is N-[3-[[(pyrimidin-2-ylamino)carbamoylamino]methyl]phenyl]acetamide.
| Compound Name | N-[3-[[(pyrimidin-2-ylamino)carbamoylamino]methyl]phenyl]acetamide |
|---|---|
| PubChem CID | 71893363 |
| Molecular Formula | C14H16N6O2 |
| Molecular Weight | 300.32 g/mol |
| Exact Mass | 300.13 |
| IUPAC Name | N-[3-[[(pyrimidin-2-ylamino)carbamoylamino]methyl]phenyl]acetamide |
| SMILES | CC(=O)Nc1cccc(CNC(=O)NNc2ncccn2)c1 |
| InChI | InChI=1S/C14H16N6O2/c1-10(21)18-12-5-2-4-11(8-12)9-17-14(22)20-19-13-15-6-3-7-16-13/h2-8H,9H2,1H3,(H,18,21)(H,15,16,19)(H2,17,20,22) |
| InChIKey | JOKCGYPEILODHU-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 108.04 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.32 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|