C27H29ClN2O2S — CID 56645149
2-(3-chloro-N-(2-thiophen-2-ylacetyl)anilino)-N-cyclohexyl-2-(2-methylphenyl)acetamide (PubChem CID 56645149) has the molecular formula C27H29ClN2O2S and a molecular weight of 481.06 g/mol. Its IUPAC name is 2-(3-chloro-N-(2-thiophen-2-ylacetyl)anilino)-N-cyclohexyl-2-(2-methylphenyl)acetamide.
| Compound Name | 2-(3-chloro-N-(2-thiophen-2-ylacetyl)anilino)-N-cyclohexyl-2-(2-methylphenyl)acetamide |
|---|---|
| PubChem CID | 56645149 |
| Molecular Formula | C27H29ClN2O2S |
| Molecular Weight | 481.06 g/mol |
| Exact Mass | 480.16 |
| IUPAC Name | 2-(3-chloro-N-(2-thiophen-2-ylacetyl)anilino)-N-cyclohexyl-2-(2-methylphenyl)acetamide |
| SMILES | Cc1ccccc1C(C(=O)NC1CCCCC1)N(C(=O)Cc1cccs1)c1cccc(Cl)c1 |
| InChI | InChI=1S/C27H29ClN2O2S/c1-19-9-5-6-15-24(19)26(27(32)29-21-11-3-2-4-12-21)30(22-13-7-10-20(28)17-22)25(31)18-23-14-8-16-33-23/h5-10,13-17,21,26H,2-4,11-12,18H2,1H3,(H,29,32) |
| InChIKey | CJYXKJDANOUTME-UHFFFAOYSA-N |
| XLogP | 6.48 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.06 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |