C26H25N5O — CID 56645596
(E)-3-[6-[4-(1-aminocyclobutyl)phenyl]-2-methyl-7-phenylimidazo[1,2-b]pyridazin-3-yl]prop-2-enamide (PubChem CID 56645596) has the molecular formula C26H25N5O and a molecular weight of 423.52 g/mol. Its IUPAC name is (E)-3-[6-[4-(1-aminocyclobutyl)phenyl]-2-methyl-7-phenylimidazo[1,2-b]pyridazin-3-yl]prop-2-enamide.
| Compound Name | (E)-3-[6-[4-(1-aminocyclobutyl)phenyl]-2-methyl-7-phenylimidazo[1,2-b]pyridazin-3-yl]prop-2-enamide |
|---|---|
| PubChem CID | 56645596 |
| Molecular Formula | C26H25N5O |
| Molecular Weight | 423.52 g/mol |
| Exact Mass | 423.21 |
| IUPAC Name | (E)-3-[6-[4-(1-aminocyclobutyl)phenyl]-2-methyl-7-phenylimidazo[1,2-b]pyridazin-3-yl]prop-2-enamide |
| SMILES | Cc1nc2cc(-c3ccccc3)c(-c3ccc(C4(N)CCC4)cc3)nn2c1/C=C/C(N)=O |
| InChI | InChI=1S/C26H25N5O/c1-17-22(12-13-23(27)32)31-24(29-17)16-21(18-6-3-2-4-7-18)25(30-31)19-8-10-20(11-9-19)26(28)14-5-15-26/h2-4,6-13,16H,5,14-15,28H2,1H3,(H2,27,32)/b13-12+ |
| InChIKey | QYLGZFIYBBKRBS-OUKQBFOZSA-N |
| XLogP | 4.21 |
| TPSA | 99.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.52 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|