C24H29N7O4 — CID 56647177
2-N,4-N-bis(1,3-benzodioxol-5-ylmethyl)-6-N-[3-(dimethylamino)propyl]-1,3,5-triazine-2,4,6-triamine (PubChem CID 56647177) has the molecular formula C24H29N7O4 and a molecular weight of 479.54 g/mol. Its IUPAC name is 2-N,4-N-bis(1,3-benzodioxol-5-ylmethyl)-6-N-[3-(dimethylamino)propyl]-1,3,5-triazine-2,4,6-triamine.
| Compound Name | 2-N,4-N-bis(1,3-benzodioxol-5-ylmethyl)-6-N-[3-(dimethylamino)propyl]-1,3,5-triazine-2,4,6-triamine |
|---|---|
| PubChem CID | 56647177 |
| Molecular Formula | C24H29N7O4 |
| Molecular Weight | 479.54 g/mol |
| Exact Mass | 479.23 |
| IUPAC Name | 2-N,4-N-bis(1,3-benzodioxol-5-ylmethyl)-6-N-[3-(dimethylamino)propyl]-1,3,5-triazine-2,4,6-triamine |
| SMILES | CN(C)CCCNc1nc(NCc2ccc3c(c2)OCO3)nc(NCc2ccc3c(c2)OCO3)n1 |
| InChI | InChI=1S/C24H29N7O4/c1-31(2)9-3-8-25-22-28-23(26-12-16-4-6-18-20(10-16)34-14-32-18)30-24(29-22)27-13-17-5-7-19-21(11-17)35-15-33-19/h4-7,10-11H,3,8-9,12-15H2,1-2H3,(H3,25,26,27,28,29,30) |
| InChIKey | GFCNYOGZIWLIOS-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 114.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.54 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|