C28H37NO7Si — CID 56648828
tert-butyl (3R,3aR,6aR)-3-[(1S)-2-[tert-butyl(diphenyl)silyl]oxy-1-hydroxyethyl]-5-oxo-3,3a,6,6a-tetrahydrofuro[2,3-d][1,2]oxazole-2-carboxylate (PubChem CID 56648828) has the molecular formula C28H37NO7Si and a molecular weight of 527.69 g/mol. Its IUPAC name is tert-butyl (3R,3aR,6aR)-3-[(1S)-2-[tert-butyl(diphenyl)silyl]oxy-1-hydroxyethyl]-5-oxo-3,3a,6,6a-tetrahydrofuro[2,3-d][1,2]oxazole-2-carboxylate.
| Compound Name | tert-butyl (3R,3aR,6aR)-3-[(1S)-2-[tert-butyl(diphenyl)silyl]oxy-1-hydroxyethyl]-5-oxo-3,3a,6,6a-tetrahydrofuro[2,3-d][1,2]oxazole-2-carboxylate |
|---|---|
| PubChem CID | 56648828 |
| Molecular Formula | C28H37NO7Si |
| Molecular Weight | 527.69 g/mol |
| Exact Mass | 527.23 |
| IUPAC Name | tert-butyl (3R,3aR,6aR)-3-[(1S)-2-[tert-butyl(diphenyl)silyl]oxy-1-hydroxyethyl]-5-oxo-3,3a,6,6a-tetrahydrofuro[2,3-d][1,2]oxazole-2-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1O[C@@H]2CC(=O)O[C@@H]2[C@H]1[C@H](O)CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C28H37NO7Si/c1-27(2,3)35-26(32)29-24(25-22(36-29)17-23(31)34-25)21(30)18-33-37(28(4,5)6,19-13-9-7-10-14-19)20-15-11-8-12-16-20/h7-16,21-22,24-25,30H,17-18H2,1-6H3/t21-,22-,24-,25+/m1/s1 |
| InChIKey | FZLZUOAPLIOEQK-MFYODDQASA-N |
| XLogP | 3.16 |
| TPSA | 94.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.69 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|