C24H31NO5Si — CID 56648830
(3R,3aR,6aR)-3-[(1S)-2-[tert-butyl(diphenyl)silyl]oxy-1-hydroxyethyl]-2-methyl-3,3a,6,6a-tetrahydrofuro[2,3-d][1,2]oxazol-5-one (PubChem CID 56648830) has the molecular formula C24H31NO5Si and a molecular weight of 441.60 g/mol. Its IUPAC name is (3R,3aR,6aR)-3-[(1S)-2-[tert-butyl(diphenyl)silyl]oxy-1-hydroxyethyl]-2-methyl-3,3a,6,6a-tetrahydrofuro[2,3-d][1,2]oxazol-5-one.
| Compound Name | (3R,3aR,6aR)-3-[(1S)-2-[tert-butyl(diphenyl)silyl]oxy-1-hydroxyethyl]-2-methyl-3,3a,6,6a-tetrahydrofuro[2,3-d][1,2]oxazol-5-one |
|---|---|
| PubChem CID | 56648830 |
| Molecular Formula | C24H31NO5Si |
| Molecular Weight | 441.60 g/mol |
| Exact Mass | 441.20 |
| IUPAC Name | (3R,3aR,6aR)-3-[(1S)-2-[tert-butyl(diphenyl)silyl]oxy-1-hydroxyethyl]-2-methyl-3,3a,6,6a-tetrahydrofuro[2,3-d][1,2]oxazol-5-one |
| SMILES | CN1O[C@@H]2CC(=O)O[C@@H]2[C@H]1[C@H](O)CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C24H31NO5Si/c1-24(2,3)31(17-11-7-5-8-12-17,18-13-9-6-10-14-18)28-16-19(26)22-23-20(30-25(22)4)15-21(27)29-23/h5-14,19-20,22-23,26H,15-16H2,1-4H3/t19-,20-,22-,23+/m1/s1 |
| InChIKey | ATQHWRGYJNTXDV-PRTQVNTJSA-N |
| XLogP | 1.85 |
| TPSA | 68.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.60 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|