C23H29NO5Si — CID 56648829
(3R,3aR,6aR)-3-[(1S)-2-[tert-butyl(diphenyl)silyl]oxy-1-hydroxyethyl]-3,3a,6,6a-tetrahydro-2H-furo[2,3-d][1,2]oxazol-5-one (PubChem CID 56648829) has the molecular formula C23H29NO5Si and a molecular weight of 427.57 g/mol. Its IUPAC name is (3R,3aR,6aR)-3-[(1S)-2-[tert-butyl(diphenyl)silyl]oxy-1-hydroxyethyl]-3,3a,6,6a-tetrahydro-2H-furo[2,3-d][1,2]oxazol-5-one.
| Compound Name | (3R,3aR,6aR)-3-[(1S)-2-[tert-butyl(diphenyl)silyl]oxy-1-hydroxyethyl]-3,3a,6,6a-tetrahydro-2H-furo[2,3-d][1,2]oxazol-5-one |
|---|---|
| PubChem CID | 56648829 |
| Molecular Formula | C23H29NO5Si |
| Molecular Weight | 427.57 g/mol |
| Exact Mass | 427.18 |
| IUPAC Name | (3R,3aR,6aR)-3-[(1S)-2-[tert-butyl(diphenyl)silyl]oxy-1-hydroxyethyl]-3,3a,6,6a-tetrahydro-2H-furo[2,3-d][1,2]oxazol-5-one |
| SMILES | CC(C)(C)[Si](OC[C@@H](O)[C@H]1NO[C@@H]2CC(=O)O[C@H]12)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C23H29NO5Si/c1-23(2,3)30(16-10-6-4-7-11-16,17-12-8-5-9-13-17)27-15-18(25)21-22-19(29-24-21)14-20(26)28-22/h4-13,18-19,21-22,24-25H,14-15H2,1-3H3/t18-,19-,21-,22+/m1/s1 |
| InChIKey | QSCPBCBEAURUBB-CZAYHTPWSA-N |
| XLogP | 1.51 |
| TPSA | 77.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.57 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|