C17H16N4O5 — CID 56649743
(1S,2S,4S,5S)-1'-methoxy-2',9-dioxospiro[6-oxabicyclo[3.2.2]nonane-4,3'-indole]-2-carbonyl azide (PubChem CID 56649743) has the molecular formula C17H16N4O5 and a molecular weight of 356.34 g/mol. Its IUPAC name is (1S,2S,4S,5S)-1'-methoxy-2',9-dioxospiro[6-oxabicyclo[3.2.2]nonane-4,3'-indole]-2-carbonyl azide.
| Compound Name | (1S,2S,4S,5S)-1'-methoxy-2',9-dioxospiro[6-oxabicyclo[3.2.2]nonane-4,3'-indole]-2-carbonyl azide |
|---|---|
| PubChem CID | 56649743 |
| Molecular Formula | C17H16N4O5 |
| Molecular Weight | 356.34 g/mol |
| Exact Mass | 356.11 |
| IUPAC Name | (1S,2S,4S,5S)-1'-methoxy-2',9-dioxospiro[6-oxabicyclo[3.2.2]nonane-4,3'-indole]-2-carbonyl azide |
| SMILES | CON1C(=O)[C@@]2(C[C@H](C(=O)N=[N+]=[N-])[C@H]3CO[C@@H]2C(=O)C3)c2ccccc21 |
| InChI | InChI=1S/C17H16N4O5/c1-25-21-12-5-3-2-4-11(12)17(16(21)24)7-10(15(23)19-20-18)9-6-13(22)14(17)26-8-9/h2-5,9-10,14H,6-8H2,1H3/t9-,10+,14-,17+/m1/s1 |
| InChIKey | YKIOIVRWIJECFV-WYOIRBSXSA-N |
| XLogP | 1.66 |
| TPSA | 121.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.34 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|