C16H16O4 — CID 56650530
4-(2-methoxyphenyl)-4,6,7,8-tetrahydro-3H-chromene-2,5-dione (PubChem CID 56650530) has the molecular formula C16H16O4 and a molecular weight of 272.30 g/mol. Its IUPAC name is 4-(2-methoxyphenyl)-4,6,7,8-tetrahydro-3H-chromene-2,5-dione.
| Compound Name | 4-(2-methoxyphenyl)-4,6,7,8-tetrahydro-3H-chromene-2,5-dione |
|---|---|
| PubChem CID | 56650530 |
| Molecular Formula | C16H16O4 |
| Molecular Weight | 272.30 g/mol |
| Exact Mass | 272.10 |
| IUPAC Name | 4-(2-methoxyphenyl)-4,6,7,8-tetrahydro-3H-chromene-2,5-dione |
| SMILES | COc1ccccc1C1CC(=O)OC2=C1C(=O)CCC2 |
| InChI | InChI=1S/C16H16O4/c1-19-13-7-3-2-5-10(13)11-9-15(18)20-14-8-4-6-12(17)16(11)14/h2-3,5,7,11H,4,6,8-9H2,1H3 |
| InChIKey | HWSYCWDCIHHVEJ-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.30 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |