C21H34ClNO6S — CID 56655942
methyl (2R,3R)-3-(tert-butylsulfinylamino)-7-chloro-2-(3,4,5-trimethoxyphenyl)heptanoate (PubChem CID 56655942) has the molecular formula C21H34ClNO6S and a molecular weight of 464.02 g/mol. Its IUPAC name is methyl (2R,3R)-3-(tert-butylsulfinylamino)-7-chloro-2-(3,4,5-trimethoxyphenyl)heptanoate.
| Compound Name | methyl (2R,3R)-3-(tert-butylsulfinylamino)-7-chloro-2-(3,4,5-trimethoxyphenyl)heptanoate |
|---|---|
| PubChem CID | 56655942 |
| Molecular Formula | C21H34ClNO6S |
| Molecular Weight | 464.02 g/mol |
| Exact Mass | 463.18 |
| IUPAC Name | methyl (2R,3R)-3-(tert-butylsulfinylamino)-7-chloro-2-(3,4,5-trimethoxyphenyl)heptanoate |
| SMILES | COC(=O)[C@H](c1cc(OC)c(OC)c(OC)c1)[C@@H](CCCCCl)NS(=O)C(C)(C)C |
| InChI | InChI=1S/C21H34ClNO6S/c1-21(2,3)30(25)23-15(10-8-9-11-22)18(20(24)29-7)14-12-16(26-4)19(28-6)17(13-14)27-5/h12-13,15,18,23H,8-11H2,1-7H3/t15-,18-,30?/m1/s1 |
| InChIKey | LOWHFTGKBDETJE-VNCBFWDDSA-N |
| XLogP | 3.80 |
| TPSA | 83.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.02 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|