C17H15FN6O — CID 56659192
N-[(E)-benzylideneamino]-1-(4-fluoroanilino)-5-methyltriazole-4-carboxamide (PubChem CID 56659192) has the molecular formula C17H15FN6O and a molecular weight of 338.35 g/mol. Its IUPAC name is N-[(E)-benzylideneamino]-1-(4-fluoroanilino)-5-methyltriazole-4-carboxamide.
| Compound Name | N-[(E)-benzylideneamino]-1-(4-fluoroanilino)-5-methyltriazole-4-carboxamide |
|---|---|
| PubChem CID | 56659192 |
| Molecular Formula | C17H15FN6O |
| Molecular Weight | 338.35 g/mol |
| Exact Mass | 338.13 |
| IUPAC Name | N-[(E)-benzylideneamino]-1-(4-fluoroanilino)-5-methyltriazole-4-carboxamide |
| SMILES | Cc1c(C(=O)N/N=C/c2ccccc2)nnn1Nc1ccc(F)cc1 |
| InChI | InChI=1S/C17H15FN6O/c1-12-16(17(25)21-19-11-13-5-3-2-4-6-13)20-23-24(12)22-15-9-7-14(18)8-10-15/h2-11,22H,1H3,(H,21,25)/b19-11+ |
| InChIKey | WZMKETCHSGIHIN-YBFXNURJSA-N |
| XLogP | 2.36 |
| TPSA | 84.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.35 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|