C15H13BrN6O2 — CID 56679718
1-(4-bromoanilino)-N-[(E)-furan-2-ylmethylideneamino]-5-methyltriazole-4-carboxamide (PubChem CID 56679718) has the molecular formula C15H13BrN6O2 and a molecular weight of 389.21 g/mol. Its IUPAC name is 1-(4-bromoanilino)-N-[(E)-furan-2-ylmethylideneamino]-5-methyltriazole-4-carboxamide.
| Compound Name | 1-(4-bromoanilino)-N-[(E)-furan-2-ylmethylideneamino]-5-methyltriazole-4-carboxamide |
|---|---|
| PubChem CID | 56679718 |
| Molecular Formula | C15H13BrN6O2 |
| Molecular Weight | 389.21 g/mol |
| Exact Mass | 388.03 |
| IUPAC Name | 1-(4-bromoanilino)-N-[(E)-furan-2-ylmethylideneamino]-5-methyltriazole-4-carboxamide |
| SMILES | Cc1c(C(=O)N/N=C/c2ccco2)nnn1Nc1ccc(Br)cc1 |
| InChI | InChI=1S/C15H13BrN6O2/c1-10-14(15(23)19-17-9-13-3-2-8-24-13)18-21-22(10)20-12-6-4-11(16)5-7-12/h2-9,20H,1H3,(H,19,23)/b17-9+ |
| InChIKey | NNFLNMGLCXLVNO-RQZCQDPDSA-N |
| XLogP | 2.58 |
| TPSA | 97.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.21 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|