C23H29FN4O2 — CID 56665903
(NZ)-N-[[2-(cyclohexylmethoxy)-3-pyridinyl]-[4-(4-fluorophenyl)piperazin-1-yl]methylidene]hydroxylamine (PubChem CID 56665903) has the molecular formula C23H29FN4O2 and a molecular weight of 412.51 g/mol. Its IUPAC name is (NZ)-N-[[2-(cyclohexylmethoxy)-3-pyridinyl]-[4-(4-fluorophenyl)piperazin-1-yl]methylidene]hydroxylamine.
| Compound Name | (NZ)-N-[[2-(cyclohexylmethoxy)-3-pyridinyl]-[4-(4-fluorophenyl)piperazin-1-yl]methylidene]hydroxylamine |
|---|---|
| PubChem CID | 56665903 |
| Molecular Formula | C23H29FN4O2 |
| Molecular Weight | 412.51 g/mol |
| Exact Mass | 412.23 |
| IUPAC Name | (NZ)-N-[[2-(cyclohexylmethoxy)-3-pyridinyl]-[4-(4-fluorophenyl)piperazin-1-yl]methylidene]hydroxylamine |
| SMILES | O/N=C(/c1cccnc1OCC1CCCCC1)N1CCN(c2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C23H29FN4O2/c24-19-8-10-20(11-9-19)27-13-15-28(16-14-27)22(26-29)21-7-4-12-25-23(21)30-17-18-5-2-1-3-6-18/h4,7-12,18,29H,1-3,5-6,13-17H2/b26-22- |
| InChIKey | HGATVRWNXXUBIE-ROMGYVFFSA-N |
| XLogP | 4.14 |
| TPSA | 61.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.51 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|