C20H16FN3O2 — CID 56672672
(NZ)-N-[1,3-dihydroisoindol-2-yl-[2-(4-fluorophenoxy)-3-pyridinyl]methylidene]hydroxylamine (PubChem CID 56672672) has the molecular formula C20H16FN3O2 and a molecular weight of 349.37 g/mol. Its IUPAC name is (NZ)-N-[1,3-dihydroisoindol-2-yl-[2-(4-fluorophenoxy)-3-pyridinyl]methylidene]hydroxylamine.
| Compound Name | (NZ)-N-[1,3-dihydroisoindol-2-yl-[2-(4-fluorophenoxy)-3-pyridinyl]methylidene]hydroxylamine |
|---|---|
| PubChem CID | 56672672 |
| Molecular Formula | C20H16FN3O2 |
| Molecular Weight | 349.37 g/mol |
| Exact Mass | 349.12 |
| IUPAC Name | (NZ)-N-[1,3-dihydroisoindol-2-yl-[2-(4-fluorophenoxy)-3-pyridinyl]methylidene]hydroxylamine |
| SMILES | O/N=C(/c1cccnc1Oc1ccc(F)cc1)N1Cc2ccccc2C1 |
| InChI | InChI=1S/C20H16FN3O2/c21-16-7-9-17(10-8-16)26-20-18(6-3-11-22-20)19(23-25)24-12-14-4-1-2-5-15(14)13-24/h1-11,25H,12-13H2/b23-19- |
| InChIKey | LZJMOQFAPXJBAT-NMWGTECJSA-N |
| XLogP | 4.16 |
| TPSA | 57.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.37 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|