C23H20N6O2 — CID 56658069
(NZ)-N-[3,4-dihydro-2H-quinolin-1-yl-[2-[4-(1,2,4-triazol-1-yl)phenoxy]-3-pyridinyl]methylidene]hydroxylamine (PubChem CID 56658069) has the molecular formula C23H20N6O2 and a molecular weight of 412.45 g/mol. Its IUPAC name is (NZ)-N-[3,4-dihydro-2H-quinolin-1-yl-[2-[4-(1,2,4-triazol-1-yl)phenoxy]-3-pyridinyl]methylidene]hydroxylamine.
| Compound Name | (NZ)-N-[3,4-dihydro-2H-quinolin-1-yl-[2-[4-(1,2,4-triazol-1-yl)phenoxy]-3-pyridinyl]methylidene]hydroxylamine |
|---|---|
| PubChem CID | 56658069 |
| Molecular Formula | C23H20N6O2 |
| Molecular Weight | 412.45 g/mol |
| Exact Mass | 412.16 |
| IUPAC Name | (NZ)-N-[3,4-dihydro-2H-quinolin-1-yl-[2-[4-(1,2,4-triazol-1-yl)phenoxy]-3-pyridinyl]methylidene]hydroxylamine |
| SMILES | O/N=C(/c1cccnc1Oc1ccc(-n2cncn2)cc1)N1CCCc2ccccc21 |
| InChI | InChI=1S/C23H20N6O2/c30-27-22(28-14-4-6-17-5-1-2-8-21(17)28)20-7-3-13-25-23(20)31-19-11-9-18(10-12-19)29-16-24-15-26-29/h1-3,5,7-13,15-16,30H,4,6,14H2/b27-22- |
| InChIKey | UIYDNQJIBGFBRS-QYQHSDTDSA-N |
| XLogP | 4.04 |
| TPSA | 88.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.45 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|