C24H20BFN2O4S — CID 56666437
[4-[[4-[(Z)-[3-[(4-fluorophenyl)methyl]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]anilino]methyl]phenyl]boronic acid (PubChem CID 56666437) has the molecular formula C24H20BFN2O4S and a molecular weight of 462.31 g/mol. Its IUPAC name is [4-[[4-[(Z)-[3-[(4-fluorophenyl)methyl]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]anilino]methyl]phenyl]boronic acid.
| Compound Name | [4-[[4-[(Z)-[3-[(4-fluorophenyl)methyl]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]anilino]methyl]phenyl]boronic acid |
|---|---|
| PubChem CID | 56666437 |
| Molecular Formula | C24H20BFN2O4S |
| Molecular Weight | 462.31 g/mol |
| Exact Mass | 462.12 |
| IUPAC Name | [4-[[4-[(Z)-[3-[(4-fluorophenyl)methyl]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]anilino]methyl]phenyl]boronic acid |
| SMILES | O=C1S/C(=C\c2ccc(NCc3ccc(B(O)O)cc3)cc2)C(=O)N1Cc1ccc(F)cc1 |
| InChI | InChI=1S/C24H20BFN2O4S/c26-20-9-3-18(4-10-20)15-28-23(29)22(33-24(28)30)13-16-5-11-21(12-6-16)27-14-17-1-7-19(8-2-17)25(31)32/h1-13,27,31-32H,14-15H2/b22-13- |
| InChIKey | AIDZXEMDYPDCTD-XKZIYDEJSA-N |
| XLogP | 3.35 |
| TPSA | 89.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.31 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|