C20H15Cl2F2N3O2 — CID 56671972
2-(2,5-dichlorophenoxy)-N'-[(2,6-difluorophenyl)methyl]-N-hydroxy-6-methylpyridine-3-carboximidamide (PubChem CID 56671972) has the molecular formula C20H15Cl2F2N3O2 and a molecular weight of 438.26 g/mol. Its IUPAC name is 2-(2,5-dichlorophenoxy)-N'-[(2,6-difluorophenyl)methyl]-N-hydroxy-6-methylpyridine-3-carboximidamide.
| Compound Name | 2-(2,5-dichlorophenoxy)-N'-[(2,6-difluorophenyl)methyl]-N-hydroxy-6-methylpyridine-3-carboximidamide |
|---|---|
| PubChem CID | 56671972 |
| Molecular Formula | C20H15Cl2F2N3O2 |
| Molecular Weight | 438.26 g/mol |
| Exact Mass | 437.05 |
| IUPAC Name | 2-(2,5-dichlorophenoxy)-N'-[(2,6-difluorophenyl)methyl]-N-hydroxy-6-methylpyridine-3-carboximidamide |
| SMILES | Cc1ccc(/C(=N/Cc2c(F)cccc2F)NO)c(Oc2cc(Cl)ccc2Cl)n1 |
| InChI | InChI=1S/C20H15Cl2F2N3O2/c1-11-5-7-13(20(26-11)29-18-9-12(21)6-8-15(18)22)19(27-28)25-10-14-16(23)3-2-4-17(14)24/h2-9,28H,10H2,1H3,(H,25,27) |
| InChIKey | DIXXIKYECVJBNA-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 66.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.26 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|