C24H19N3O3S — CID 56679439
2-dibenzofuran-2-yloxy-N-hydroxy-6-methyl-N'-(thiophen-2-ylmethyl)pyridine-3-carboximidamide (PubChem CID 56679439) has the molecular formula C24H19N3O3S and a molecular weight of 429.50 g/mol. Its IUPAC name is 2-dibenzofuran-2-yloxy-N-hydroxy-6-methyl-N'-(thiophen-2-ylmethyl)pyridine-3-carboximidamide.
| Compound Name | 2-dibenzofuran-2-yloxy-N-hydroxy-6-methyl-N'-(thiophen-2-ylmethyl)pyridine-3-carboximidamide |
|---|---|
| PubChem CID | 56679439 |
| Molecular Formula | C24H19N3O3S |
| Molecular Weight | 429.50 g/mol |
| Exact Mass | 429.11 |
| IUPAC Name | 2-dibenzofuran-2-yloxy-N-hydroxy-6-methyl-N'-(thiophen-2-ylmethyl)pyridine-3-carboximidamide |
| SMILES | Cc1ccc(/C(=N/Cc2cccs2)NO)c(Oc2ccc3oc4ccccc4c3c2)n1 |
| InChI | InChI=1S/C24H19N3O3S/c1-15-8-10-19(23(27-28)25-14-17-5-4-12-31-17)24(26-15)29-16-9-11-22-20(13-16)18-6-2-3-7-21(18)30-22/h2-13,28H,14H2,1H3,(H,25,27) |
| InChIKey | DDKFRVKBFHUBCL-UHFFFAOYSA-N |
| XLogP | 6.07 |
| TPSA | 79.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.50 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|