C23H21N3O3 — CID 56672920
N'-cyclobutyl-2-dibenzofuran-2-yloxy-N-hydroxy-6-methylpyridine-3-carboximidamide (PubChem CID 56672920) has the molecular formula C23H21N3O3 and a molecular weight of 387.44 g/mol. Its IUPAC name is N'-cyclobutyl-2-dibenzofuran-2-yloxy-N-hydroxy-6-methylpyridine-3-carboximidamide.
| Compound Name | N'-cyclobutyl-2-dibenzofuran-2-yloxy-N-hydroxy-6-methylpyridine-3-carboximidamide |
|---|---|
| PubChem CID | 56672920 |
| Molecular Formula | C23H21N3O3 |
| Molecular Weight | 387.44 g/mol |
| Exact Mass | 387.16 |
| IUPAC Name | N'-cyclobutyl-2-dibenzofuran-2-yloxy-N-hydroxy-6-methylpyridine-3-carboximidamide |
| SMILES | Cc1ccc(/C(=N\C2CCC2)NO)c(Oc2ccc3oc4ccccc4c3c2)n1 |
| InChI | InChI=1S/C23H21N3O3/c1-14-9-11-18(22(26-27)25-15-5-4-6-15)23(24-14)28-16-10-12-21-19(13-16)17-7-2-3-8-20(17)29-21/h2-3,7-13,15,27H,4-6H2,1H3,(H,25,26) |
| InChIKey | LHBMBZOVGSPUNJ-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 79.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.44 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|