C18H20FN3O2 — CID 56665012
N'-cyclopentyl-2-(3-fluorophenoxy)-N-hydroxy-6-methylpyridine-3-carboximidamide (PubChem CID 56665012) has the molecular formula C18H20FN3O2 and a molecular weight of 329.38 g/mol. Its IUPAC name is N'-cyclopentyl-2-(3-fluorophenoxy)-N-hydroxy-6-methylpyridine-3-carboximidamide.
| Compound Name | N'-cyclopentyl-2-(3-fluorophenoxy)-N-hydroxy-6-methylpyridine-3-carboximidamide |
|---|---|
| PubChem CID | 56665012 |
| Molecular Formula | C18H20FN3O2 |
| Molecular Weight | 329.38 g/mol |
| Exact Mass | 329.15 |
| IUPAC Name | N'-cyclopentyl-2-(3-fluorophenoxy)-N-hydroxy-6-methylpyridine-3-carboximidamide |
| SMILES | Cc1ccc(/C(=N/C2CCCC2)NO)c(Oc2cccc(F)c2)n1 |
| InChI | InChI=1S/C18H20FN3O2/c1-12-9-10-16(17(22-23)21-14-6-2-3-7-14)18(20-12)24-15-8-4-5-13(19)11-15/h4-5,8-11,14,23H,2-3,6-7H2,1H3,(H,21,22) |
| InChIKey | RJHILCZHODPSEC-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 66.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.38 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|