C20H18FN3O2 — CID 56675749
2-(3-fluorophenoxy)-N'-hydroxy-N,6-dimethyl-N-phenylpyridine-3-carboximidamide (PubChem CID 56675749) has the molecular formula C20H18FN3O2 and a molecular weight of 351.38 g/mol. Its IUPAC name is 2-(3-fluorophenoxy)-N'-hydroxy-N,6-dimethyl-N-phenylpyridine-3-carboximidamide.
| Compound Name | 2-(3-fluorophenoxy)-N'-hydroxy-N,6-dimethyl-N-phenylpyridine-3-carboximidamide |
|---|---|
| PubChem CID | 56675749 |
| Molecular Formula | C20H18FN3O2 |
| Molecular Weight | 351.38 g/mol |
| Exact Mass | 351.14 |
| IUPAC Name | 2-(3-fluorophenoxy)-N'-hydroxy-N,6-dimethyl-N-phenylpyridine-3-carboximidamide |
| SMILES | Cc1ccc(/C(=N/O)N(C)c2ccccc2)c(Oc2cccc(F)c2)n1 |
| InChI | InChI=1S/C20H18FN3O2/c1-14-11-12-18(19(23-25)24(2)16-8-4-3-5-9-16)20(22-14)26-17-10-6-7-15(21)13-17/h3-13,25H,1-2H3/b23-19- |
| InChIKey | BLDUHKOABDQZHF-NMWGTECJSA-N |
| XLogP | 4.59 |
| TPSA | 57.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.38 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|