C24H33N3O2 — CID 56665400
2-(3,5-dimethylphenoxy)-N-hydroxy-6-methyl-N'-(3,3,5-trimethylcyclohexyl)pyridine-3-carboximidamide (PubChem CID 56665400) has the molecular formula C24H33N3O2 and a molecular weight of 395.55 g/mol. Its IUPAC name is 2-(3,5-dimethylphenoxy)-N-hydroxy-6-methyl-N'-(3,3,5-trimethylcyclohexyl)pyridine-3-carboximidamide.
| Compound Name | 2-(3,5-dimethylphenoxy)-N-hydroxy-6-methyl-N'-(3,3,5-trimethylcyclohexyl)pyridine-3-carboximidamide |
|---|---|
| PubChem CID | 56665400 |
| Molecular Formula | C24H33N3O2 |
| Molecular Weight | 395.55 g/mol |
| Exact Mass | 395.26 |
| IUPAC Name | 2-(3,5-dimethylphenoxy)-N-hydroxy-6-methyl-N'-(3,3,5-trimethylcyclohexyl)pyridine-3-carboximidamide |
| SMILES | Cc1cc(C)cc(Oc2nc(C)ccc2/C(=N/C2CC(C)CC(C)(C)C2)NO)c1 |
| InChI | InChI=1S/C24H33N3O2/c1-15-9-16(2)12-20(11-15)29-23-21(8-7-18(4)25-23)22(27-28)26-19-10-17(3)13-24(5,6)14-19/h7-9,11-12,17,19,28H,10,13-14H2,1-6H3,(H,26,27) |
| InChIKey | BRFKKVGYOTXXMF-UHFFFAOYSA-N |
| XLogP | 5.74 |
| TPSA | 66.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.55 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|