C22H28N6O4 — CID 56672291
[(1S,3R,4R,7S)-3-[6-amino-2-(butylamino)purin-9-yl]-7-phenylmethoxy-2,5-dioxabicyclo[2.2.1]heptan-1-yl]methanol (PubChem CID 56672291) has the molecular formula C22H28N6O4 and a molecular weight of 440.50 g/mol. Its IUPAC name is [(1S,3R,4R,7S)-3-[6-amino-2-(butylamino)purin-9-yl]-7-phenylmethoxy-2,5-dioxabicyclo[2.2.1]heptan-1-yl]methanol.
| Compound Name | [(1S,3R,4R,7S)-3-[6-amino-2-(butylamino)purin-9-yl]-7-phenylmethoxy-2,5-dioxabicyclo[2.2.1]heptan-1-yl]methanol |
|---|---|
| PubChem CID | 56672291 |
| Molecular Formula | C22H28N6O4 |
| Molecular Weight | 440.50 g/mol |
| Exact Mass | 440.22 |
| IUPAC Name | [(1S,3R,4R,7S)-3-[6-amino-2-(butylamino)purin-9-yl]-7-phenylmethoxy-2,5-dioxabicyclo[2.2.1]heptan-1-yl]methanol |
| SMILES | CCCCNc1nc(N)c2ncn([C@@H]3O[C@@]4(CO)CO[C@@H]3[C@@H]4OCc3ccccc3)c2n1 |
| InChI | InChI=1S/C22H28N6O4/c1-2-3-9-24-21-26-18(23)15-19(27-21)28(13-25-15)20-16-17(22(11-29,32-20)12-31-16)30-10-14-7-5-4-6-8-14/h4-8,13,16-17,20,29H,2-3,9-12H2,1H3,(H3,23,24,26,27)/t16-,17+,20-,22+/m1/s1 |
| InChIKey | ADVPKWPOQKNYLE-FIBVWIARSA-N |
| XLogP | 1.86 |
| TPSA | 129.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.50 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|