C10H17N2O6P — CID 56676852
2-[2-(5-methyl-2,4-dioxopyrimidin-1-yl)ethoxy]propylphosphonic acid (PubChem CID 56676852) has the molecular formula C10H17N2O6P and a molecular weight of 292.23 g/mol. Its IUPAC name is 2-[2-(5-methyl-2,4-dioxopyrimidin-1-yl)ethoxy]propylphosphonic acid.
| Compound Name | 2-[2-(5-methyl-2,4-dioxopyrimidin-1-yl)ethoxy]propylphosphonic acid |
|---|---|
| PubChem CID | 56676852 |
| Molecular Formula | C10H17N2O6P |
| Molecular Weight | 292.23 g/mol |
| Exact Mass | 292.08 |
| IUPAC Name | 2-[2-(5-methyl-2,4-dioxopyrimidin-1-yl)ethoxy]propylphosphonic acid |
| SMILES | Cc1cn(CCOC(C)CP(=O)(O)O)c(=O)[nH]c1=O |
| InChI | InChI=1S/C10H17N2O6P/c1-7-5-12(10(14)11-9(7)13)3-4-18-8(2)6-19(15,16)17/h5,8H,3-4,6H2,1-2H3,(H,11,13,14)(H2,15,16,17) |
| InChIKey | TXZYDRYANYUIEM-UHFFFAOYSA-N |
| XLogP | -0.57 |
| TPSA | 121.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.23 |
| LogP ≤ 5 | -0.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|