C27H29F5O3S — CID 56678023
5-hydroxy-6-methyl-9-(4-methylsulfanylphenyl)-5-(1,1,2,2,2-pentafluoroethyl)-8-oxatetracyclo[8.8.0.02,6.011,16]octadeca-10,15-dien-14-one (PubChem CID 56678023) has the molecular formula C27H29F5O3S and a molecular weight of 528.58 g/mol. Its IUPAC name is 5-hydroxy-6-methyl-9-(4-methylsulfanylphenyl)-5-(1,1,2,2,2-pentafluoroethyl)-8-oxatetracyclo[8.8.0.02,6.011,16]octadeca-10,15-dien-14-one.
| Compound Name | 5-hydroxy-6-methyl-9-(4-methylsulfanylphenyl)-5-(1,1,2,2,2-pentafluoroethyl)-8-oxatetracyclo[8.8.0.02,6.011,16]octadeca-10,15-dien-14-one |
|---|---|
| PubChem CID | 56678023 |
| Molecular Formula | C27H29F5O3S |
| Molecular Weight | 528.58 g/mol |
| Exact Mass | 528.18 |
| IUPAC Name | 5-hydroxy-6-methyl-9-(4-methylsulfanylphenyl)-5-(1,1,2,2,2-pentafluoroethyl)-8-oxatetracyclo[8.8.0.02,6.011,16]octadeca-10,15-dien-14-one |
| SMILES | CSc1ccc(C2OCC3(C)C(CCC3(O)C(F)(F)C(F)(F)F)C3CCC4=CC(=O)CCC4=C23)cc1 |
| InChI | InChI=1S/C27H29F5O3S/c1-24-14-35-23(15-3-7-18(36-2)8-4-15)22-19-10-6-17(33)13-16(19)5-9-20(22)21(24)11-12-25(24,34)26(28,29)27(30,31)32/h3-4,7-8,13,20-21,23,34H,5-6,9-12,14H2,1-2H3 |
| InChIKey | GCKMJAVBEKTJOI-UHFFFAOYSA-N |
| XLogP | 6.82 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.58 |
| LogP ≤ 5 | 6.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|