C19H23N3O2 — CID 56679502
(NZ)-N-[[6-(2,4-dimethylphenoxy)-3-pyridinyl]-piperidin-1-ylmethylidene]hydroxylamine (PubChem CID 56679502) has the molecular formula C19H23N3O2 and a molecular weight of 325.41 g/mol. Its IUPAC name is (NZ)-N-[[6-(2,4-dimethylphenoxy)-3-pyridinyl]-piperidin-1-ylmethylidene]hydroxylamine.
| Compound Name | (NZ)-N-[[6-(2,4-dimethylphenoxy)-3-pyridinyl]-piperidin-1-ylmethylidene]hydroxylamine |
|---|---|
| PubChem CID | 56679502 |
| Molecular Formula | C19H23N3O2 |
| Molecular Weight | 325.41 g/mol |
| Exact Mass | 325.18 |
| IUPAC Name | (NZ)-N-[[6-(2,4-dimethylphenoxy)-3-pyridinyl]-piperidin-1-ylmethylidene]hydroxylamine |
| SMILES | Cc1ccc(Oc2ccc(/C(=N/O)N3CCCCC3)cn2)c(C)c1 |
| InChI | InChI=1S/C19H23N3O2/c1-14-6-8-17(15(2)12-14)24-18-9-7-16(13-20-18)19(21-23)22-10-4-3-5-11-22/h6-9,12-13,23H,3-5,10-11H2,1-2H3/b21-19- |
| InChIKey | IALWQFWVTGUSJB-VZCXRCSSSA-N |
| XLogP | 4.11 |
| TPSA | 57.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.41 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|