C18H19N3O2 — CID 56683862
(NZ)-N-[2,5-dihydropyrrol-1-yl-(6-methyl-2-phenylmethoxy-3-pyridinyl)methylidene]hydroxylamine (PubChem CID 56683862) has the molecular formula C18H19N3O2 and a molecular weight of 309.37 g/mol. Its IUPAC name is (NZ)-N-[2,5-dihydropyrrol-1-yl-(6-methyl-2-phenylmethoxy-3-pyridinyl)methylidene]hydroxylamine.
| Compound Name | (NZ)-N-[2,5-dihydropyrrol-1-yl-(6-methyl-2-phenylmethoxy-3-pyridinyl)methylidene]hydroxylamine |
|---|---|
| PubChem CID | 56683862 |
| Molecular Formula | C18H19N3O2 |
| Molecular Weight | 309.37 g/mol |
| Exact Mass | 309.15 |
| IUPAC Name | (NZ)-N-[2,5-dihydropyrrol-1-yl-(6-methyl-2-phenylmethoxy-3-pyridinyl)methylidene]hydroxylamine |
| SMILES | Cc1ccc(/C(=N/O)N2CC=CC2)c(OCc2ccccc2)n1 |
| InChI | InChI=1S/C18H19N3O2/c1-14-9-10-16(17(20-22)21-11-5-6-12-21)18(19-14)23-13-15-7-3-2-4-8-15/h2-10,22H,11-13H2,1H3/b20-17- |
| InChIKey | GDOMEJDKCZQXEE-JZJYNLBNSA-N |
| XLogP | 2.98 |
| TPSA | 57.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.37 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|