C21H13N5O6 — CID 56692972
2-[naphthalene-2-carbonyl(1,2,4-triazol-4-yl)carbamoyl]-3-nitrobenzoic acid (PubChem CID 56692972) has the molecular formula C21H13N5O6 and a molecular weight of 431.36 g/mol. Its IUPAC name is 2-[naphthalene-2-carbonyl(1,2,4-triazol-4-yl)carbamoyl]-3-nitrobenzoic acid.
| Compound Name | 2-[naphthalene-2-carbonyl(1,2,4-triazol-4-yl)carbamoyl]-3-nitrobenzoic acid |
|---|---|
| PubChem CID | 56692972 |
| Molecular Formula | C21H13N5O6 |
| Molecular Weight | 431.36 g/mol |
| Exact Mass | 431.09 |
| IUPAC Name | 2-[naphthalene-2-carbonyl(1,2,4-triazol-4-yl)carbamoyl]-3-nitrobenzoic acid |
| SMILES | O=C(O)c1cccc([N+](=O)[O-])c1C(=O)N(C(=O)c1ccc2ccccc2c1)n1cnnc1 |
| InChI | InChI=1S/C21H13N5O6/c27-19(15-9-8-13-4-1-2-5-14(13)10-15)25(24-11-22-23-12-24)20(28)18-16(21(29)30)6-3-7-17(18)26(31)32/h1-12H,(H,29,30) |
| InChIKey | FUWZYSQWHVVZQJ-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 148.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.36 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|