C16H18N4O2S — CID 56693783
2-benzylsulfanyl-5,7-diethoxy-[1,2,4]triazolo[1,5-a]pyrimidine (PubChem CID 56693783) has the molecular formula C16H18N4O2S and a molecular weight of 330.41 g/mol. Its IUPAC name is 2-benzylsulfanyl-5,7-diethoxy-[1,2,4]triazolo[1,5-a]pyrimidine.
| Compound Name | 2-benzylsulfanyl-5,7-diethoxy-[1,2,4]triazolo[1,5-a]pyrimidine |
|---|---|
| PubChem CID | 56693783 |
| Molecular Formula | C16H18N4O2S |
| Molecular Weight | 330.41 g/mol |
| Exact Mass | 330.12 |
| IUPAC Name | 2-benzylsulfanyl-5,7-diethoxy-[1,2,4]triazolo[1,5-a]pyrimidine |
| SMILES | CCOc1cc(OCC)n2nc(SCc3ccccc3)nc2n1 |
| InChI | InChI=1S/C16H18N4O2S/c1-3-21-13-10-14(22-4-2)20-15(17-13)18-16(19-20)23-11-12-8-6-5-7-9-12/h5-10H,3-4,11H2,1-2H3 |
| InChIKey | BWXMDZQSQHRMJG-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 61.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.41 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |