C13H16Cl2N6S — CID 45262126
(2-benzylsulfanyl-5-methyl-[1,2,4]triazolo[1,5-a]pyrimidin-7-yl)hydrazine;dihydrochloride (PubChem CID 45262126) has the molecular formula C13H16Cl2N6S and a molecular weight of 359.29 g/mol. Its IUPAC name is (2-benzylsulfanyl-5-methyl-[1,2,4]triazolo[1,5-a]pyrimidin-7-yl)hydrazine;dihydrochloride.
| Compound Name | (2-benzylsulfanyl-5-methyl-[1,2,4]triazolo[1,5-a]pyrimidin-7-yl)hydrazine;dihydrochloride |
|---|---|
| PubChem CID | 45262126 |
| Molecular Formula | C13H16Cl2N6S |
| Molecular Weight | 359.29 g/mol |
| Exact Mass | 358.05 |
| IUPAC Name | (2-benzylsulfanyl-5-methyl-[1,2,4]triazolo[1,5-a]pyrimidin-7-yl)hydrazine;dihydrochloride |
| SMILES | Cc1cc(NN)n2nc(SCc3ccccc3)nc2n1.Cl.Cl |
| InChI | InChI=1S/C13H14N6S.2ClH/c1-9-7-11(17-14)19-12(15-9)16-13(18-19)20-8-10-5-3-2-4-6-10;;/h2-7,17H,8,14H2,1H3;2*1H |
| InChIKey | BOPHILBOTPDDTP-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 81.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.29 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|