C9H10N6S — CID 155544121
(5-methyl-2-prop-2-ynylsulfanyl-[1,2,4]triazolo[1,5-a]pyrimidin-7-yl)hydrazine (PubChem CID 155544121) has the molecular formula C9H10N6S and a molecular weight of 234.29 g/mol. Its IUPAC name is (5-methyl-2-prop-2-ynylsulfanyl-[1,2,4]triazolo[1,5-a]pyrimidin-7-yl)hydrazine.
| Compound Name | (5-methyl-2-prop-2-ynylsulfanyl-[1,2,4]triazolo[1,5-a]pyrimidin-7-yl)hydrazine |
|---|---|
| PubChem CID | 155544121 |
| Molecular Formula | C9H10N6S |
| Molecular Weight | 234.29 g/mol |
| Exact Mass | 234.07 |
| IUPAC Name | (5-methyl-2-prop-2-ynylsulfanyl-[1,2,4]triazolo[1,5-a]pyrimidin-7-yl)hydrazine |
| SMILES | C#CCSc1nc2nc(C)cc(NN)n2n1 |
| InChI | InChI=1S/C9H10N6S/c1-3-4-16-9-12-8-11-6(2)5-7(13-10)15(8)14-9/h1,5,13H,4,10H2,2H3 |
| InChIKey | NZURAIMBDJTJEI-UHFFFAOYSA-N |
| XLogP | 0.44 |
| TPSA | 81.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.29 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|