C16H16N4S — CID 14155101
11-benzylsulfanyl-7-methyl-1,8,10,12-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),7,9,11-tetraene (PubChem CID 14155101) has the molecular formula C16H16N4S and a molecular weight of 296.40 g/mol. Its IUPAC name is 11-benzylsulfanyl-7-methyl-1,8,10,12-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),7,9,11-tetraene.
| Compound Name | 11-benzylsulfanyl-7-methyl-1,8,10,12-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),7,9,11-tetraene |
|---|---|
| PubChem CID | 14155101 |
| Molecular Formula | C16H16N4S |
| Molecular Weight | 296.40 g/mol |
| Exact Mass | 296.11 |
| IUPAC Name | 11-benzylsulfanyl-7-methyl-1,8,10,12-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),7,9,11-tetraene |
| SMILES | Cc1nc2nc(SCc3ccccc3)nn2c2c1CCC2 |
| InChI | InChI=1S/C16H16N4S/c1-11-13-8-5-9-14(13)20-15(17-11)18-16(19-20)21-10-12-6-3-2-4-7-12/h2-4,6-7H,5,8-10H2,1H3 |
| InChIKey | CBNRCFYRQMPUHU-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 43.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.40 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |