C28H34F2N2O4 — CID 56694067
1,6-bis(4-fluorophenyl)-2,5-bis(morpholin-4-ylmethyl)hexane-1,6-dione (PubChem CID 56694067) has the molecular formula C28H34F2N2O4 and a molecular weight of 500.59 g/mol. Its IUPAC name is 1,6-bis(4-fluorophenyl)-2,5-bis(morpholin-4-ylmethyl)hexane-1,6-dione.
| Compound Name | 1,6-bis(4-fluorophenyl)-2,5-bis(morpholin-4-ylmethyl)hexane-1,6-dione |
|---|---|
| PubChem CID | 56694067 |
| Molecular Formula | C28H34F2N2O4 |
| Molecular Weight | 500.59 g/mol |
| Exact Mass | 500.25 |
| IUPAC Name | 1,6-bis(4-fluorophenyl)-2,5-bis(morpholin-4-ylmethyl)hexane-1,6-dione |
| SMILES | O=C(c1ccc(F)cc1)C(CCC(CN1CCOCC1)C(=O)c1ccc(F)cc1)CN1CCOCC1 |
| InChI | InChI=1S/C28H34F2N2O4/c29-25-7-3-21(4-8-25)27(33)23(19-31-11-15-35-16-12-31)1-2-24(20-32-13-17-36-18-14-32)28(34)22-5-9-26(30)10-6-22/h3-10,23-24H,1-2,11-20H2 |
| InChIKey | VCYZJDKOQWALDU-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.59 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |