About 4-nitro-1-oxido-5-piperidin-1-yl-2,1,3-benzoxadiazol-1-ium
4-nitro-1-oxido-5-piperidin-1-yl-2,1,3-benzoxadiazol-1-ium (PubChem CID 56695868) has the molecular formula C11H12N4O4
and a molecular weight of 264.24 g/mol. Its IUPAC name is 4-nitro-1-oxido-5-piperidin-1-yl-2,1,3-benzoxadiazol-1-ium.
Molecular Properties
| Compound Name | 4-nitro-1-oxido-5-piperidin-1-yl-2,1,3-benzoxadiazol-1-ium |
| PubChem CID | 56695868 |
| Molecular Formula | C11H12N4O4 |
| Molecular Weight | 264.24 g/mol |
| Exact Mass | 264.09 |
| IUPAC Name | 4-nitro-1-oxido-5-piperidin-1-yl-2,1,3-benzoxadiazol-1-ium |
| SMILES | O=[N+]([O-])c1c(N2CCCCC2)ccc2c1no[n+]2[O-] |
| InChI | InChI=1S/C11H12N4O4/c16-14(17)11-9(13-6-2-1-3-7-13)5-4-8-10(11)12-19-15(8)18/h4-5H,1-3,6-7H2 |
| InChIKey | UMSGUZRVBUYPGD-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 99.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 264.24 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-nitro-1-oxido-5-piperidin-1-yl-2,1,3-benzoxadiazol-1-ium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-nitro-1-oxido-5-piperidin-1-yl-2,1,3-benzoxadiazol-1-ium?
The IUPAC name of 4-nitro-1-oxido-5-piperidin-1-yl-2,1,3-benzoxadiazol-1-ium (CID 56695868) is 4-nitro-1-oxido-5-piperidin-1-yl-2,1,3-benzoxadiazol-1-ium.
What is the SMILES notation for 4-nitro-1-oxido-5-piperidin-1-yl-2,1,3-benzoxadiazol-1-ium?
The canonical SMILES for 4-nitro-1-oxido-5-piperidin-1-yl-2,1,3-benzoxadiazol-1-ium is O=[N+]([O-])c1c(N2CCCCC2)ccc2c1no[n+]2[O-].
What is the InChIKey of 4-nitro-1-oxido-5-piperidin-1-yl-2,1,3-benzoxadiazol-1-ium?
The InChIKey is UMSGUZRVBUYPGD-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12N4O4/c16-14(17)11-9(13-6-2-1-3-7-13)5-4-8-10(11)12-19-15(8)18/h4-5H,1-3,6-7H2.
What are the key properties of 4-nitro-1-oxido-5-piperidin-1-yl-2,1,3-benzoxadiazol-1-ium?
4-nitro-1-oxido-5-piperidin-1-yl-2,1,3-benzoxadiazol-1-ium has a molecular weight of 264.24 g/mol, XLogP of 1.36, 2 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-nitro-1-oxido-5-piperidin-1-yl-2,1,3-benzoxadiazol-1-ium is sourced from PubChem (CID 56695868), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).