C15H24N2O3 — CID 56702364
5-ethoxy-N-[(1-ethylpiperidin-3-yl)methyl]furan-2-carboxamide (PubChem CID 56702364) has the molecular formula C15H24N2O3 and a molecular weight of 280.37 g/mol. Its IUPAC name is 5-ethoxy-N-[(1-ethylpiperidin-3-yl)methyl]furan-2-carboxamide.
| Compound Name | 5-ethoxy-N-[(1-ethylpiperidin-3-yl)methyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 56702364 |
| Molecular Formula | C15H24N2O3 |
| Molecular Weight | 280.37 g/mol |
| Exact Mass | 280.18 |
| IUPAC Name | 5-ethoxy-N-[(1-ethylpiperidin-3-yl)methyl]furan-2-carboxamide |
| SMILES | CCOc1ccc(C(=O)NCC2CCCN(CC)C2)o1 |
| InChI | InChI=1S/C15H24N2O3/c1-3-17-9-5-6-12(11-17)10-16-15(18)13-7-8-14(20-13)19-4-2/h7-8,12H,3-6,9-11H2,1-2H3,(H,16,18) |
| InChIKey | QRGFFACMNBLDTA-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 54.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.37 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |