C21H25N3O — CID 94811143
N-[[(3R)-1-ethylpiperidin-3-yl]methyl]-3H-benzo[e]indole-2-carboxamide (PubChem CID 94811143) has the molecular formula C21H25N3O and a molecular weight of 335.45 g/mol. Its IUPAC name is N-[[(3R)-1-ethylpiperidin-3-yl]methyl]-3H-benzo[e]indole-2-carboxamide.
| Compound Name | N-[[(3R)-1-ethylpiperidin-3-yl]methyl]-3H-benzo[e]indole-2-carboxamide |
|---|---|
| PubChem CID | 94811143 |
| Molecular Formula | C21H25N3O |
| Molecular Weight | 335.45 g/mol |
| Exact Mass | 335.20 |
| IUPAC Name | N-[[(3R)-1-ethylpiperidin-3-yl]methyl]-3H-benzo[e]indole-2-carboxamide |
| SMILES | CCN1CCC[C@H](CNC(=O)c2cc3c(ccc4ccccc43)[nH]2)C1 |
| InChI | InChI=1S/C21H25N3O/c1-2-24-11-5-6-15(14-24)13-22-21(25)20-12-18-17-8-4-3-7-16(17)9-10-19(18)23-20/h3-4,7-10,12,15,23H,2,5-6,11,13-14H2,1H3,(H,22,25)/t15-/m1/s1 |
| InChIKey | NEGXBUMKWHYOEV-OAHLLOKOSA-N |
| XLogP | 3.78 |
| TPSA | 48.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.45 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |