C13H24N2O2 — CID 56708215
3-methoxy-N-methyl-N-[2-(1-methyl-3,6-dihydro-2H-pyridin-4-yl)ethyl]propanamide (PubChem CID 56708215) has the molecular formula C13H24N2O2 and a molecular weight of 240.35 g/mol. Its IUPAC name is 3-methoxy-N-methyl-N-[2-(1-methyl-3,6-dihydro-2H-pyridin-4-yl)ethyl]propanamide.
| Compound Name | 3-methoxy-N-methyl-N-[2-(1-methyl-3,6-dihydro-2H-pyridin-4-yl)ethyl]propanamide |
|---|---|
| PubChem CID | 56708215 |
| Molecular Formula | C13H24N2O2 |
| Molecular Weight | 240.35 g/mol |
| Exact Mass | 240.18 |
| IUPAC Name | 3-methoxy-N-methyl-N-[2-(1-methyl-3,6-dihydro-2H-pyridin-4-yl)ethyl]propanamide |
| SMILES | COCCC(=O)N(C)CCC1=CCN(C)CC1 |
| InChI | InChI=1S/C13H24N2O2/c1-14-8-4-12(5-9-14)6-10-15(2)13(16)7-11-17-3/h4H,5-11H2,1-3H3 |
| InChIKey | RQAYUOLASMWHAU-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.35 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|