C19H28N6 — CID 56708629
3-[4-(3-azaspiro[5.5]undecan-9-yl)piperazin-1-yl]pyrazine-2-carbonitrile (PubChem CID 56708629) has the molecular formula C19H28N6 and a molecular weight of 340.48 g/mol. Its IUPAC name is 3-[4-(3-azaspiro[5.5]undecan-9-yl)piperazin-1-yl]pyrazine-2-carbonitrile.
| Compound Name | 3-[4-(3-azaspiro[5.5]undecan-9-yl)piperazin-1-yl]pyrazine-2-carbonitrile |
|---|---|
| PubChem CID | 56708629 |
| Molecular Formula | C19H28N6 |
| Molecular Weight | 340.48 g/mol |
| Exact Mass | 340.24 |
| IUPAC Name | 3-[4-(3-azaspiro[5.5]undecan-9-yl)piperazin-1-yl]pyrazine-2-carbonitrile |
| SMILES | N#Cc1nccnc1N1CCN(C2CCC3(CCNCC3)CC2)CC1 |
| InChI | InChI=1S/C19H28N6/c20-15-17-18(23-10-9-22-17)25-13-11-24(12-14-25)16-1-3-19(4-2-16)5-7-21-8-6-19/h9-10,16,21H,1-8,11-14H2 |
| InChIKey | OOBIBMNMRWWLFI-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 68.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.48 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |