C14H22N2S — CID 56715283
N-[1-(3-methyl-2-pyridinyl)propan-2-yl]thian-4-amine (PubChem CID 56715283) has the molecular formula C14H22N2S and a molecular weight of 250.41 g/mol. Its IUPAC name is N-[1-(3-methyl-2-pyridinyl)propan-2-yl]thian-4-amine.
| Compound Name | N-[1-(3-methyl-2-pyridinyl)propan-2-yl]thian-4-amine |
|---|---|
| PubChem CID | 56715283 |
| Molecular Formula | C14H22N2S |
| Molecular Weight | 250.41 g/mol |
| Exact Mass | 250.15 |
| IUPAC Name | N-[1-(3-methyl-2-pyridinyl)propan-2-yl]thian-4-amine |
| SMILES | Cc1cccnc1CC(C)NC1CCSCC1 |
| InChI | InChI=1S/C14H22N2S/c1-11-4-3-7-15-14(11)10-12(2)16-13-5-8-17-9-6-13/h3-4,7,12-13,16H,5-6,8-10H2,1-2H3 |
| InChIKey | CVRRHZJGVVAEHX-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.41 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |