C23H29FN4O2 — CID 56715379
1-[(3-fluorophenyl)methyl]-N-(1,4,5,6,7,8-hexahydrocyclohepta[d]pyrazol-3-ylmethyl)-N-methyl-6-oxopiperidine-3-carboxamide (PubChem CID 56715379) has the molecular formula C23H29FN4O2 and a molecular weight of 412.51 g/mol. Its IUPAC name is 1-[(3-fluorophenyl)methyl]-N-(1,4,5,6,7,8-hexahydrocyclohepta[d]pyrazol-3-ylmethyl)-N-methyl-6-oxopiperidine-3-carboxamide.
| Compound Name | 1-[(3-fluorophenyl)methyl]-N-(1,4,5,6,7,8-hexahydrocyclohepta[d]pyrazol-3-ylmethyl)-N-methyl-6-oxopiperidine-3-carboxamide |
|---|---|
| PubChem CID | 56715379 |
| Molecular Formula | C23H29FN4O2 |
| Molecular Weight | 412.51 g/mol |
| Exact Mass | 412.23 |
| IUPAC Name | 1-[(3-fluorophenyl)methyl]-N-(1,4,5,6,7,8-hexahydrocyclohepta[d]pyrazol-3-ylmethyl)-N-methyl-6-oxopiperidine-3-carboxamide |
| SMILES | CN(Cc1n[nH]c2c1CCCCC2)C(=O)C1CCC(=O)N(Cc2cccc(F)c2)C1 |
| InChI | InChI=1S/C23H29FN4O2/c1-27(15-21-19-8-3-2-4-9-20(19)25-26-21)23(30)17-10-11-22(29)28(14-17)13-16-6-5-7-18(24)12-16/h5-7,12,17H,2-4,8-11,13-15H2,1H3,(H,25,26) |
| InChIKey | KFTOGHVDDLSSAN-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 69.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.51 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |